C19H26N4O5 — CID 122086504
2-[cyclopropylmethyl-[3-[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122086504) has the molecular formula C19H26N4O5 and a molecular weight of 390.44 g/mol. Its IUPAC name is 2-[cyclopropylmethyl-[3-[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[cyclopropylmethyl-[3-[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122086504 |
| Molecular Formula | C19H26N4O5 |
| Molecular Weight | 390.44 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | 2-[cyclopropylmethyl-[3-[(2,6-dimethyl-3-nitrophenyl)carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | Cc1ccc([N+](=O)[O-])c(C)c1NC(=O)NC1CC(N(CC(=O)O)CC2CC2)C1 |
| InChI | InChI=1S/C19H26N4O5/c1-11-3-6-16(23(27)28)12(2)18(11)21-19(26)20-14-7-15(8-14)22(10-17(24)25)9-13-4-5-13/h3,6,13-15H,4-5,7-10H2,1-2H3,(H,24,25)(H2,20,21,26) |
| InChIKey | VMVGNTABZVMQKG-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.44 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|