C18H24N2O5S — CID 122072273
7-[4-(diethylcarbamoyl)phenyl]sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 122072273) has the molecular formula C18H24N2O5S and a molecular weight of 380.47 g/mol. Its IUPAC name is 7-[4-(diethylcarbamoyl)phenyl]sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-[4-(diethylcarbamoyl)phenyl]sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 122072273 |
| Molecular Formula | C18H24N2O5S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 7-[4-(diethylcarbamoyl)phenyl]sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | CCN(CC)C(=O)c1ccc(S(=O)(=O)N2C3CCC2C(C(=O)O)C3)cc1 |
| InChI | InChI=1S/C18H24N2O5S/c1-3-19(4-2)17(21)12-5-8-14(9-6-12)26(24,25)20-13-7-10-16(20)15(11-13)18(22)23/h5-6,8-9,13,15-16H,3-4,7,10-11H2,1-2H3,(H,22,23) |
| InChIKey | GBBQJXGHBOWGED-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |