C20H19NO5S — CID 122072532
7-(2-benzoylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 122072532) has the molecular formula C20H19NO5S and a molecular weight of 385.44 g/mol. Its IUPAC name is 7-(2-benzoylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-(2-benzoylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 122072532 |
| Molecular Formula | C20H19NO5S |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 7-(2-benzoylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(c1ccccc1)c1ccccc1S(=O)(=O)N1C2CCC1C(C(=O)O)C2 |
| InChI | InChI=1S/C20H19NO5S/c22-19(13-6-2-1-3-7-13)15-8-4-5-9-18(15)27(25,26)21-14-10-11-17(21)16(12-14)20(23)24/h1-9,14,16-17H,10-12H2,(H,23,24) |
| InChIKey | PBZMEQQBLUKEOT-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |