C14H16FNO4S — CID 122072534
7-(2-fluoro-6-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 122072534) has the molecular formula C14H16FNO4S and a molecular weight of 313.35 g/mol. Its IUPAC name is 7-(2-fluoro-6-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-(2-fluoro-6-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 122072534 |
| Molecular Formula | C14H16FNO4S |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.08 |
| IUPAC Name | 7-(2-fluoro-6-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | Cc1cccc(F)c1S(=O)(=O)N1C2CCC1C(C(=O)O)C2 |
| InChI | InChI=1S/C14H16FNO4S/c1-8-3-2-4-11(15)13(8)21(19,20)16-9-5-6-12(16)10(7-9)14(17)18/h2-4,9-10,12H,5-7H2,1H3,(H,17,18) |
| InChIKey | GUUCGDKFROYVFQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |