C15H19NO4S — CID 74078880
methyl 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 74078880) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is methyl 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 74078880 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | methyl 7-(4-methylphenyl)sulfonyl-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)C1CC2CCC1N2S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-10-3-6-12(7-4-10)21(18,19)16-11-5-8-14(16)13(9-11)15(17)20-2/h3-4,6-7,11,13-14H,5,8-9H2,1-2H3 |
| InChIKey | VUCYOUXQDPPDNT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |