C17H21NO5S — CID 177217687
methyl 2-[6-(4-methylphenyl)sulfonyl-7-oxo-6-azaspiro[3.4]octan-5-yl]acetate (PubChem CID 177217687) has the molecular formula C17H21NO5S and a molecular weight of 351.42 g/mol. Its IUPAC name is methyl 2-[6-(4-methylphenyl)sulfonyl-7-oxo-6-azaspiro[3.4]octan-5-yl]acetate.
| Compound Name | methyl 2-[6-(4-methylphenyl)sulfonyl-7-oxo-6-azaspiro[3.4]octan-5-yl]acetate |
|---|---|
| PubChem CID | 177217687 |
| Molecular Formula | C17H21NO5S |
| Molecular Weight | 351.42 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | methyl 2-[6-(4-methylphenyl)sulfonyl-7-oxo-6-azaspiro[3.4]octan-5-yl]acetate |
| SMILES | COC(=O)CC1N(S(=O)(=O)c2ccc(C)cc2)C(=O)CC12CCC2 |
| InChI | InChI=1S/C17H21NO5S/c1-12-4-6-13(7-5-12)24(21,22)18-14(10-16(20)23-2)17(8-3-9-17)11-15(18)19/h4-7,14H,3,8-11H2,1-2H3 |
| InChIKey | KVJIYOOVWDQBGE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.42 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |