C20H28N4O4 — CID 122075709
2-[ethyl-[3-[[3-(2-oxopiperidin-1-yl)phenyl]carbamoylamino]cyclobutyl]amino]acetic acid (PubChem CID 122075709) has the molecular formula C20H28N4O4 and a molecular weight of 388.47 g/mol. Its IUPAC name is 2-[ethyl-[3-[[3-(2-oxopiperidin-1-yl)phenyl]carbamoylamino]cyclobutyl]amino]acetic acid.
| Compound Name | 2-[ethyl-[3-[[3-(2-oxopiperidin-1-yl)phenyl]carbamoylamino]cyclobutyl]amino]acetic acid |
|---|---|
| PubChem CID | 122075709 |
| Molecular Formula | C20H28N4O4 |
| Molecular Weight | 388.47 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[ethyl-[3-[[3-(2-oxopiperidin-1-yl)phenyl]carbamoylamino]cyclobutyl]amino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)Nc2cccc(N3CCCCC3=O)c2)C1 |
| InChI | InChI=1S/C20H28N4O4/c1-2-23(13-19(26)27)17-11-15(12-17)22-20(28)21-14-6-5-7-16(10-14)24-9-4-3-8-18(24)25/h5-7,10,15,17H,2-4,8-9,11-13H2,1H3,(H,26,27)(H2,21,22,28) |
| InChIKey | HVVZUYQWENRKGR-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 101.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |