C19H21N3O3 — CID 122075877
4-[[2-(2,3-dihydroindol-1-yl)phenyl]carbamoylamino]butanoic acid (PubChem CID 122075877) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-[[2-(2,3-dihydroindol-1-yl)phenyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[2-(2,3-dihydroindol-1-yl)phenyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122075877 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 4-[[2-(2,3-dihydroindol-1-yl)phenyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)Nc1ccccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C19H21N3O3/c23-18(24)10-5-12-20-19(25)21-15-7-2-4-9-17(15)22-13-11-14-6-1-3-8-16(14)22/h1-4,6-9H,5,10-13H2,(H,23,24)(H2,20,21,25) |
| InChIKey | FTCOBDIYUIHNCQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|