C18H21N3O2 — CID 110891302
1-[2-(2,3-dihydroindol-1-yl)phenyl]-3-(3-hydroxypropyl)urea (PubChem CID 110891302) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-[2-(2,3-dihydroindol-1-yl)phenyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[2-(2,3-dihydroindol-1-yl)phenyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 110891302 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 1-[2-(2,3-dihydroindol-1-yl)phenyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)Nc1ccccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C18H21N3O2/c22-13-5-11-19-18(23)20-15-7-2-4-9-17(15)21-12-10-14-6-1-3-8-16(14)21/h1-4,6-9,22H,5,10-13H2,(H2,19,20,23) |
| InChIKey | HKXSTVGRRBSISC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 64.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|