About 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea
3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea (PubChem CID 84597316) has the molecular formula C19H23N3O2
and a molecular weight of 325.41 g/mol. Its IUPAC name is 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea.
Molecular Properties
| Compound Name | 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea |
| PubChem CID | 84597316 |
| Molecular Formula | C19H23N3O2 |
| Molecular Weight | 325.41 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea |
| SMILES | CC(CO)N(C)C(=O)Nc1ccccc1N1CCc2ccccc21 |
| InChI | InChI=1S/C19H23N3O2/c1-14(13-23)21(2)19(24)20-16-8-4-6-10-18(16)22-12-11-15-7-3-5-9-17(15)22/h3-10,14,23H,11-13H2,1-2H3,(H,20,24) |
| InChIKey | JJJITPLLOIGVKF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.41 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea?
The IUPAC name of 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea (CID 84597316) is 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea.
What is the SMILES notation for 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea?
The canonical SMILES for 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea is CC(CO)N(C)C(=O)Nc1ccccc1N1CCc2ccccc21.
What is the InChIKey of 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea?
The InChIKey is JJJITPLLOIGVKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N3O2/c1-14(13-23)21(2)19(24)20-16-8-4-6-10-18(16)22-12-11-15-7-3-5-9-17(15)22/h3-10,14,23H,11-13H2,1-2H3,(H,20,24).
What are the key properties of 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea?
3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea has a molecular weight of 325.41 g/mol, XLogP of 3.23, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(2,3-dihydroindol-1-yl)phenyl]-1-(1-hydroxypropan-2-yl)-1-methylurea is sourced from PubChem (CID 84597316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).