C21H25N3O4 — CID 122076052
4-methyl-4-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoylamino]pentanoic acid (PubChem CID 122076052) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 4-methyl-4-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoylamino]pentanoic acid.
| Compound Name | 4-methyl-4-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoylamino]pentanoic acid |
|---|---|
| PubChem CID | 122076052 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 4-methyl-4-[[2-methyl-5-(phenylcarbamoyl)phenyl]carbamoylamino]pentanoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccccc2)cc1NC(=O)NC(C)(C)CCC(=O)O |
| InChI | InChI=1S/C21H25N3O4/c1-14-9-10-15(19(27)22-16-7-5-4-6-8-16)13-17(14)23-20(28)24-21(2,3)12-11-18(25)26/h4-10,13H,11-12H2,1-3H3,(H,22,27)(H,25,26)(H2,23,24,28) |
| InChIKey | MLEYKXDZNYJCGB-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |