C15H20ClN3O4 — CID 122077547
3-[[3-chloro-4-(propylcarbamoyl)phenyl]carbamoyl-methylamino]propanoic acid (PubChem CID 122077547) has the molecular formula C15H20ClN3O4 and a molecular weight of 341.80 g/mol. Its IUPAC name is 3-[[3-chloro-4-(propylcarbamoyl)phenyl]carbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[3-chloro-4-(propylcarbamoyl)phenyl]carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122077547 |
| Molecular Formula | C15H20ClN3O4 |
| Molecular Weight | 341.80 g/mol |
| Exact Mass | 341.11 |
| IUPAC Name | 3-[[3-chloro-4-(propylcarbamoyl)phenyl]carbamoyl-methylamino]propanoic acid |
| SMILES | CCCNC(=O)c1ccc(NC(=O)N(C)CCC(=O)O)cc1Cl |
| InChI | InChI=1S/C15H20ClN3O4/c1-3-7-17-14(22)11-5-4-10(9-12(11)16)18-15(23)19(2)8-6-13(20)21/h4-5,9H,3,6-8H2,1-2H3,(H,17,22)(H,18,23)(H,20,21) |
| InChIKey | ADTMBLVNENELQD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.80 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |