C18H23N3O4 — CID 122077697
3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]propanoic acid (PubChem CID 122077697) has the molecular formula C18H23N3O4 and a molecular weight of 345.40 g/mol. Its IUPAC name is 3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122077697 |
| Molecular Formula | C18H23N3O4 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]propanoic acid |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(NC(=O)N(C)CCC(=O)O)cc1 |
| InChI | InChI=1S/C18H23N3O4/c1-4-11-21(12-5-2)17(24)14-6-8-15(9-7-14)19-18(25)20(3)13-10-16(22)23/h4-9H,1-2,10-13H2,3H3,(H,19,25)(H,22,23) |
| InChIKey | OGUTUZJGLOEJGM-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|