C19H25N3O4 — CID 122077702
3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]-2-methylpropanoic acid (PubChem CID 122077702) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]-2-methylpropanoic acid.
| Compound Name | 3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 122077702 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-[[4-[bis(prop-2-enyl)carbamoyl]phenyl]carbamoyl-methylamino]-2-methylpropanoic acid |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(NC(=O)N(C)CC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C19H25N3O4/c1-5-11-22(12-6-2)17(23)15-7-9-16(10-8-15)20-19(26)21(4)13-14(3)18(24)25/h5-10,14H,1-2,11-13H2,3-4H3,(H,20,26)(H,24,25) |
| InChIKey | PAXXZOWQUPQEKI-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|