C15H23N3O5S — CID 122074743
2-methyl-3-[methyl-[[4-(propan-2-ylsulfamoyl)phenyl]carbamoyl]amino]propanoic acid (PubChem CID 122074743) has the molecular formula C15H23N3O5S and a molecular weight of 357.43 g/mol. Its IUPAC name is 2-methyl-3-[methyl-[[4-(propan-2-ylsulfamoyl)phenyl]carbamoyl]amino]propanoic acid.
| Compound Name | 2-methyl-3-[methyl-[[4-(propan-2-ylsulfamoyl)phenyl]carbamoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122074743 |
| Molecular Formula | C15H23N3O5S |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-methyl-3-[methyl-[[4-(propan-2-ylsulfamoyl)phenyl]carbamoyl]amino]propanoic acid |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)N(C)CC(C)C(=O)O)cc1 |
| InChI | InChI=1S/C15H23N3O5S/c1-10(2)17-24(22,23)13-7-5-12(6-8-13)16-15(21)18(4)9-11(3)14(19)20/h5-8,10-11,17H,9H2,1-4H3,(H,16,21)(H,19,20) |
| InChIKey | XGZORUSEWDGMOW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 115.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |