C15H20N2O5 — CID 122083894
1-[2-(furan-2-carbonylamino)propanoyl]-6-methylpiperidine-3-carboxylic acid (PubChem CID 122083894) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 1-[2-(furan-2-carbonylamino)propanoyl]-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[2-(furan-2-carbonylamino)propanoyl]-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122083894 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 1-[2-(furan-2-carbonylamino)propanoyl]-6-methylpiperidine-3-carboxylic acid |
| SMILES | CC(NC(=O)c1ccco1)C(=O)N1CC(C(=O)O)CCC1C |
| InChI | InChI=1S/C15H20N2O5/c1-9-5-6-11(15(20)21)8-17(9)14(19)10(2)16-13(18)12-4-3-7-22-12/h3-4,7,9-11H,5-6,8H2,1-2H3,(H,16,18)(H,20,21) |
| InChIKey | JJCVBYUBJXNHBT-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 99.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |