C15H19ClN2O3 — CID 122084603
[(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(2-chloro-6-methoxyphenyl)methanone (PubChem CID 122084603) has the molecular formula C15H19ClN2O3 and a molecular weight of 310.78 g/mol. Its IUPAC name is [(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(2-chloro-6-methoxyphenyl)methanone.
| Compound Name | [(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(2-chloro-6-methoxyphenyl)methanone |
|---|---|
| PubChem CID | 122084603 |
| Molecular Formula | C15H19ClN2O3 |
| Molecular Weight | 310.78 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | [(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(2-chloro-6-methoxyphenyl)methanone |
| SMILES | COc1cccc(Cl)c1C(=O)N1C[C@H]2OCCN(C)[C@H]2C1 |
| InChI | InChI=1S/C15H19ClN2O3/c1-17-6-7-21-13-9-18(8-11(13)17)15(19)14-10(16)4-3-5-12(14)20-2/h3-5,11,13H,6-9H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | DIWUDFWQYIVCJO-WCQYABFASA-N |
| XLogP | 1.50 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.78 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |