C19H24N4O2 — CID 122084608
[(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]methanone (PubChem CID 122084608) has the molecular formula C19H24N4O2 and a molecular weight of 340.43 g/mol. Its IUPAC name is [(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]methanone.
| Compound Name | [(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]methanone |
|---|---|
| PubChem CID | 122084608 |
| Molecular Formula | C19H24N4O2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | [(4aS,7aR)-4-methyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-[3-(2,4-dimethylphenyl)-1H-pyrazol-5-yl]methanone |
| SMILES | Cc1ccc(-c2cc(C(=O)N3C[C@H]4OCCN(C)[C@H]4C3)[nH]n2)c(C)c1 |
| InChI | InChI=1S/C19H24N4O2/c1-12-4-5-14(13(2)8-12)15-9-16(21-20-15)19(24)23-10-17-18(11-23)25-7-6-22(17)3/h4-5,8-9,17-18H,6-7,10-11H2,1-3H3,(H,20,21)/t17-,18+/m0/s1 |
| InChIKey | GHDFCQSHSIJOCL-ZWKOTPCHSA-N |
| XLogP | 1.85 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |