C20H26N4O3 — CID 122084884
1-[(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)carbamoyl]pyrrolidine-3-carboxylic acid (PubChem CID 122084884) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 1-[(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)carbamoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)carbamoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122084884 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 1-[(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)carbamoyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1c(C(C)(C)C)nn(-c2ccccc2)c1NC(=O)N1CCC(C(=O)O)C1 |
| InChI | InChI=1S/C20H26N4O3/c1-13-16(20(2,3)4)22-24(15-8-6-5-7-9-15)17(13)21-19(27)23-11-10-14(12-23)18(25)26/h5-9,14H,10-12H2,1-4H3,(H,21,27)(H,25,26) |
| InChIKey | LCVQTZMRGRTVJL-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |