C23H33N5O2 — CID 71845302
N'-(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)-N-[2-[cyclopropyl(ethyl)amino]ethyl]oxamide (PubChem CID 71845302) has the molecular formula C23H33N5O2 and a molecular weight of 411.55 g/mol. Its IUPAC name is N'-(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)-N-[2-[cyclopropyl(ethyl)amino]ethyl]oxamide.
| Compound Name | N'-(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)-N-[2-[cyclopropyl(ethyl)amino]ethyl]oxamide |
|---|---|
| PubChem CID | 71845302 |
| Molecular Formula | C23H33N5O2 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.26 |
| IUPAC Name | N'-(3-tert-butyl-4-methyl-1-phenylpyrazol-5-yl)-N-[2-[cyclopropyl(ethyl)amino]ethyl]oxamide |
| SMILES | CCN(CCNC(=O)C(=O)Nc1c(C)c(C(C)(C)C)nn1-c1ccccc1)C1CC1 |
| InChI | InChI=1S/C23H33N5O2/c1-6-27(17-12-13-17)15-14-24-21(29)22(30)25-20-16(2)19(23(3,4)5)26-28(20)18-10-8-7-9-11-18/h7-11,17H,6,12-15H2,1-5H3,(H,24,29)(H,25,30) |
| InChIKey | GSVUDIWXBCHNOF-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|