C21H23N3O4 — CID 122085075
4-[[[4-[[acetyl(cyclopropyl)amino]methyl]phenyl]carbamoylamino]methyl]benzoic acid (PubChem CID 122085075) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 4-[[[4-[[acetyl(cyclopropyl)amino]methyl]phenyl]carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[[4-[[acetyl(cyclopropyl)amino]methyl]phenyl]carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122085075 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 4-[[[4-[[acetyl(cyclopropyl)amino]methyl]phenyl]carbamoylamino]methyl]benzoic acid |
| SMILES | CC(=O)N(Cc1ccc(NC(=O)NCc2ccc(C(=O)O)cc2)cc1)C1CC1 |
| InChI | InChI=1S/C21H23N3O4/c1-14(25)24(19-10-11-19)13-16-4-8-18(9-5-16)23-21(28)22-12-15-2-6-17(7-3-15)20(26)27/h2-9,19H,10-13H2,1H3,(H,26,27)(H2,22,23,28) |
| InChIKey | SCEZWEXFXUUECI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 98.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |