C19H24N2O5S — CID 122085991
(3aS,6aR)-2-[(4-cyclopropyl-3-ethoxycarbonylthiophen-2-yl)carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid (PubChem CID 122085991) has the molecular formula C19H24N2O5S and a molecular weight of 392.48 g/mol. Its IUPAC name is (3aS,6aR)-2-[(4-cyclopropyl-3-ethoxycarbonylthiophen-2-yl)carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid.
| Compound Name | (3aS,6aR)-2-[(4-cyclopropyl-3-ethoxycarbonylthiophen-2-yl)carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
|---|---|
| PubChem CID | 122085991 |
| Molecular Formula | C19H24N2O5S |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | (3aS,6aR)-2-[(4-cyclopropyl-3-ethoxycarbonylthiophen-2-yl)carbamoyl]-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole-3a-carboxylic acid |
| SMILES | CCOC(=O)c1c(C2CC2)csc1NC(=O)N1C[C@@H]2CCC[C@@]2(C(=O)O)C1 |
| InChI | InChI=1S/C19H24N2O5S/c1-2-26-16(22)14-13(11-5-6-11)9-27-15(14)20-18(25)21-8-12-4-3-7-19(12,10-21)17(23)24/h9,11-12H,2-8,10H2,1H3,(H,20,25)(H,23,24)/t12-,19+/m0/s1 |
| InChIKey | YLBMZBCSGCJXPK-HXPMCKFVSA-N |
| XLogP | 3.52 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |