C18H23FN2O4 — CID 122086184
4-[(4-cyclobutyloxy-3-fluorophenyl)carbamoylamino]cyclohexane-1-carboxylic acid (PubChem CID 122086184) has the molecular formula C18H23FN2O4 and a molecular weight of 350.39 g/mol. Its IUPAC name is 4-[(4-cyclobutyloxy-3-fluorophenyl)carbamoylamino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(4-cyclobutyloxy-3-fluorophenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122086184 |
| Molecular Formula | C18H23FN2O4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 4-[(4-cyclobutyloxy-3-fluorophenyl)carbamoylamino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(Nc1ccc(OC2CCC2)c(F)c1)NC1CCC(C(=O)O)CC1 |
| InChI | InChI=1S/C18H23FN2O4/c19-15-10-13(8-9-16(15)25-14-2-1-3-14)21-18(24)20-12-6-4-11(5-7-12)17(22)23/h8-12,14H,1-7H2,(H,22,23)(H2,20,21,24) |
| InChIKey | NAEMWPJDAWHDQH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |