C17H19N3O6 — CID 122087193
4-[[8-(2-methoxy-2-oxoethoxy)quinolin-5-yl]carbamoylamino]butanoic acid (PubChem CID 122087193) has the molecular formula C17H19N3O6 and a molecular weight of 361.35 g/mol. Its IUPAC name is 4-[[8-(2-methoxy-2-oxoethoxy)quinolin-5-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[8-(2-methoxy-2-oxoethoxy)quinolin-5-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122087193 |
| Molecular Formula | C17H19N3O6 |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.13 |
| IUPAC Name | 4-[[8-(2-methoxy-2-oxoethoxy)quinolin-5-yl]carbamoylamino]butanoic acid |
| SMILES | COC(=O)COc1ccc(NC(=O)NCCCC(=O)O)c2cccnc12 |
| InChI | InChI=1S/C17H19N3O6/c1-25-15(23)10-26-13-7-6-12(11-4-2-8-18-16(11)13)20-17(24)19-9-3-5-14(21)22/h2,4,6-8H,3,5,9-10H2,1H3,(H,21,22)(H2,19,20,24) |
| InChIKey | XURCQYKLWLKOGH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 126.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|