C17H21N3O3S — CID 122087496
2-[[3-(1-benzothiophen-7-ylcarbamoylamino)cyclobutyl]-ethylamino]acetic acid (PubChem CID 122087496) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 2-[[3-(1-benzothiophen-7-ylcarbamoylamino)cyclobutyl]-ethylamino]acetic acid.
| Compound Name | 2-[[3-(1-benzothiophen-7-ylcarbamoylamino)cyclobutyl]-ethylamino]acetic acid |
|---|---|
| PubChem CID | 122087496 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[[3-(1-benzothiophen-7-ylcarbamoylamino)cyclobutyl]-ethylamino]acetic acid |
| SMILES | CCN(CC(=O)O)C1CC(NC(=O)Nc2cccc3ccsc23)C1 |
| InChI | InChI=1S/C17H21N3O3S/c1-2-20(10-15(21)22)13-8-12(9-13)18-17(23)19-14-5-3-4-11-6-7-24-16(11)14/h3-7,12-13H,2,8-10H2,1H3,(H,21,22)(H2,18,19,23) |
| InChIKey | LXYCGXFEQAGDGW-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |