C19H24N4O3 — CID 122088267
4-[[(1-butan-2-yl-5-cyclopropylpyrazol-4-yl)carbamoylamino]methyl]benzoic acid (PubChem CID 122088267) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-[[(1-butan-2-yl-5-cyclopropylpyrazol-4-yl)carbamoylamino]methyl]benzoic acid.
| Compound Name | 4-[[(1-butan-2-yl-5-cyclopropylpyrazol-4-yl)carbamoylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122088267 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | 4-[[(1-butan-2-yl-5-cyclopropylpyrazol-4-yl)carbamoylamino]methyl]benzoic acid |
| SMILES | CCC(C)n1ncc(NC(=O)NCc2ccc(C(=O)O)cc2)c1C1CC1 |
| InChI | InChI=1S/C19H24N4O3/c1-3-12(2)23-17(14-8-9-14)16(11-21-23)22-19(26)20-10-13-4-6-15(7-5-13)18(24)25/h4-7,11-12,14H,3,8-10H2,1-2H3,(H,24,25)(H2,20,22,26) |
| InChIKey | NKVJOTIVFYOSSB-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |