C16H20Cl2N2O5 — CID 122088694
1-[[3,5-dichloro-4-(2-methoxyethoxy)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122088694) has the molecular formula C16H20Cl2N2O5 and a molecular weight of 391.25 g/mol. Its IUPAC name is 1-[[3,5-dichloro-4-(2-methoxyethoxy)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[[3,5-dichloro-4-(2-methoxyethoxy)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122088694 |
| Molecular Formula | C16H20Cl2N2O5 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.07 |
| IUPAC Name | 1-[[3,5-dichloro-4-(2-methoxyethoxy)phenyl]carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | COCCOc1c(Cl)cc(NC(=O)N2CCC(C)(C(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C16H20Cl2N2O5/c1-16(14(21)22)3-4-20(9-16)15(23)19-10-7-11(17)13(12(18)8-10)25-6-5-24-2/h7-8H,3-6,9H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | SNOQVBYUGQYAQR-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|