C14H18Cl2N2O4 — CID 129372498
(3S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 129372498) has the molecular formula C14H18Cl2N2O4 and a molecular weight of 349.21 g/mol. Its IUPAC name is (3S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 129372498 |
| Molecular Formula | C14H18Cl2N2O4 |
| Molecular Weight | 349.21 g/mol |
| Exact Mass | 348.06 |
| IUPAC Name | (3S)-N-[3,5-dichloro-4-(2-methoxyethoxy)phenyl]-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | COCCOc1c(Cl)cc(NC(=O)N2CC[C@H](O)C2)cc1Cl |
| InChI | InChI=1S/C14H18Cl2N2O4/c1-21-4-5-22-13-11(15)6-9(7-12(13)16)17-14(20)18-3-2-10(19)8-18/h6-7,10,19H,2-5,8H2,1H3,(H,17,20)/t10-/m0/s1 |
| InChIKey | ZXMDSCCIPXCQCS-JTQLQIEISA-N |
| XLogP | 2.62 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.21 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|