C16H19ClN2O3 — CID 118780562
(3R)-N-(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 118780562) has the molecular formula C16H19ClN2O3 and a molecular weight of 322.79 g/mol. Its IUPAC name is (3R)-N-(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 118780562 |
| Molecular Formula | C16H19ClN2O3 |
| Molecular Weight | 322.79 g/mol |
| Exact Mass | 322.11 |
| IUPAC Name | (3R)-N-(7-chloro-2-ethyl-3-methyl-1-benzofuran-5-yl)-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | CCc1oc2c(Cl)cc(NC(=O)N3CC[C@@H](O)C3)cc2c1C |
| InChI | InChI=1S/C16H19ClN2O3/c1-3-14-9(2)12-6-10(7-13(17)15(12)22-14)18-16(21)19-5-4-11(20)8-19/h6-7,11,20H,3-5,8H2,1-2H3,(H,18,21)/t11-/m1/s1 |
| InChIKey | RFXDCNPWKAFRLF-LLVKDONJSA-N |
| XLogP | 3.56 |
| TPSA | 65.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |