C16H19N3O7 — CID 122091465
1-[(5-methoxycarbonyl-2-methyl-3-nitrophenyl)carbamoyl]-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122091465) has the molecular formula C16H19N3O7 and a molecular weight of 365.34 g/mol. Its IUPAC name is 1-[(5-methoxycarbonyl-2-methyl-3-nitrophenyl)carbamoyl]-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(5-methoxycarbonyl-2-methyl-3-nitrophenyl)carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122091465 |
| Molecular Formula | C16H19N3O7 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 1-[(5-methoxycarbonyl-2-methyl-3-nitrophenyl)carbamoyl]-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | COC(=O)c1cc(NC(=O)N2CCC(C)(C(=O)O)C2)c(C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H19N3O7/c1-9-11(6-10(13(20)26-3)7-12(9)19(24)25)17-15(23)18-5-4-16(2,8-18)14(21)22/h6-7H,4-5,8H2,1-3H3,(H,17,23)(H,21,22) |
| InChIKey | WRKIMOWINKLPSC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 139.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|