C18H22N4O4 — CID 122092032
3-[3-[[1-methyl-3-(oxolan-2-yl)pyrazol-5-yl]carbamoylamino]phenyl]propanoic acid (PubChem CID 122092032) has the molecular formula C18H22N4O4 and a molecular weight of 358.40 g/mol. Its IUPAC name is 3-[3-[[1-methyl-3-(oxolan-2-yl)pyrazol-5-yl]carbamoylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[[1-methyl-3-(oxolan-2-yl)pyrazol-5-yl]carbamoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 122092032 |
| Molecular Formula | C18H22N4O4 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 3-[3-[[1-methyl-3-(oxolan-2-yl)pyrazol-5-yl]carbamoylamino]phenyl]propanoic acid |
| SMILES | Cn1nc(C2CCCO2)cc1NC(=O)Nc1cccc(CCC(=O)O)c1 |
| InChI | InChI=1S/C18H22N4O4/c1-22-16(11-14(21-22)15-6-3-9-26-15)20-18(25)19-13-5-2-4-12(10-13)7-8-17(23)24/h2,4-5,10-11,15H,3,6-9H2,1H3,(H,23,24)(H2,19,20,25) |
| InChIKey | NWUDWDRIIJQPQC-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 105.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |