C16H18ClN3O3S — CID 122094987
4-[[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoylamino]butanoic acid (PubChem CID 122094987) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 4-[[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 122094987 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 4-[[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]carbamoylamino]butanoic acid |
| SMILES | Cc1nc(NC(=O)NCCCC(=O)O)sc1Cc1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O3S/c1-10-13(9-11-5-2-3-6-12(11)17)24-16(19-10)20-15(23)18-8-4-7-14(21)22/h2-3,5-6H,4,7-9H2,1H3,(H,21,22)(H2,18,19,20,23) |
| InChIKey | FICITMWPJLRTCX-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 91.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|