C16H16ClF3N2O2S — CID 55895563
N-[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide (PubChem CID 55895563) has the molecular formula C16H16ClF3N2O2S and a molecular weight of 392.83 g/mol. Its IUPAC name is N-[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide.
| Compound Name | N-[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
|---|---|
| PubChem CID | 55895563 |
| Molecular Formula | C16H16ClF3N2O2S |
| Molecular Weight | 392.83 g/mol |
| Exact Mass | 392.06 |
| IUPAC Name | N-[5-[(2-chlorophenyl)methyl]-4-methyl-1,3-thiazol-2-yl]-3-(2,2,2-trifluoroethoxy)propanamide |
| SMILES | Cc1nc(NC(=O)CCOCC(F)(F)F)sc1Cc1ccccc1Cl |
| InChI | InChI=1S/C16H16ClF3N2O2S/c1-10-13(8-11-4-2-3-5-12(11)17)25-15(21-10)22-14(23)6-7-24-9-16(18,19)20/h2-5H,6-9H2,1H3,(H,21,22,23) |
| InChIKey | DSIJADVEKAVYEG-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.83 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|