C13H19ClN6 — CID 122096792
1-[2-(3-chloropyrazolo[1,5-a]pyrimidin-6-yl)ethyl]-2-(2-methylpropyl)guanidine (PubChem CID 122096792) has the molecular formula C13H19ClN6 and a molecular weight of 294.79 g/mol. Its IUPAC name is 1-[2-(3-chloropyrazolo[1,5-a]pyrimidin-6-yl)ethyl]-2-(2-methylpropyl)guanidine.
| Compound Name | 1-[2-(3-chloropyrazolo[1,5-a]pyrimidin-6-yl)ethyl]-2-(2-methylpropyl)guanidine |
|---|---|
| PubChem CID | 122096792 |
| Molecular Formula | C13H19ClN6 |
| Molecular Weight | 294.79 g/mol |
| Exact Mass | 294.14 |
| IUPAC Name | 1-[2-(3-chloropyrazolo[1,5-a]pyrimidin-6-yl)ethyl]-2-(2-methylpropyl)guanidine |
| SMILES | CC(C)C/N=C(\N)NCCc1cnc2c(Cl)cnn2c1 |
| InChI | InChI=1S/C13H19ClN6/c1-9(2)5-18-13(15)16-4-3-10-6-17-12-11(14)7-19-20(12)8-10/h6-9H,3-5H2,1-2H3,(H3,15,16,18) |
| InChIKey | COGNTFUOCUECKT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 80.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.79 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|