C12H17BrN4O — CID 122096951
2-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1-cyclopropyl-1-methylguanidine (PubChem CID 122096951) has the molecular formula C12H17BrN4O and a molecular weight of 313.20 g/mol. Its IUPAC name is 2-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1-cyclopropyl-1-methylguanidine.
| Compound Name | 2-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1-cyclopropyl-1-methylguanidine |
|---|---|
| PubChem CID | 122096951 |
| Molecular Formula | C12H17BrN4O |
| Molecular Weight | 313.20 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 2-[2-(5-bromo-2-oxo-1-pyridinyl)ethyl]-1-cyclopropyl-1-methylguanidine |
| SMILES | CN(/C(N)=N/CCn1cc(Br)ccc1=O)C1CC1 |
| InChI | InChI=1S/C12H17BrN4O/c1-16(10-3-4-10)12(14)15-6-7-17-8-9(13)2-5-11(17)18/h2,5,8,10H,3-4,6-7H2,1H3,(H2,14,15) |
| InChIKey | FFMPYCVDOSZBAN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 63.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.20 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|