C16H23NO4S — CID 122099711
2-[2-[[1-(3-methylphenyl)cyclopentyl]amino]ethylsulfonyl]acetic acid (PubChem CID 122099711) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is 2-[2-[[1-(3-methylphenyl)cyclopentyl]amino]ethylsulfonyl]acetic acid.
| Compound Name | 2-[2-[[1-(3-methylphenyl)cyclopentyl]amino]ethylsulfonyl]acetic acid |
|---|---|
| PubChem CID | 122099711 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 2-[2-[[1-(3-methylphenyl)cyclopentyl]amino]ethylsulfonyl]acetic acid |
| SMILES | Cc1cccc(C2(NCCS(=O)(=O)CC(=O)O)CCCC2)c1 |
| InChI | InChI=1S/C16H23NO4S/c1-13-5-4-6-14(11-13)16(7-2-3-8-16)17-9-10-22(20,21)12-15(18)19/h4-6,11,17H,2-3,7-10,12H2,1H3,(H,18,19) |
| InChIKey | IBWPIOPPLLRRRE-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |