C16H24FNO3S — CID 75431186
4-(3-fluorophenyl)-N-(2-propylsulfonylethyl)oxan-4-amine (PubChem CID 75431186) has the molecular formula C16H24FNO3S and a molecular weight of 329.44 g/mol. Its IUPAC name is 4-(3-fluorophenyl)-N-(2-propylsulfonylethyl)oxan-4-amine.
| Compound Name | 4-(3-fluorophenyl)-N-(2-propylsulfonylethyl)oxan-4-amine |
|---|---|
| PubChem CID | 75431186 |
| Molecular Formula | C16H24FNO3S |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.15 |
| IUPAC Name | 4-(3-fluorophenyl)-N-(2-propylsulfonylethyl)oxan-4-amine |
| SMILES | CCCS(=O)(=O)CCNC1(c2cccc(F)c2)CCOCC1 |
| InChI | InChI=1S/C16H24FNO3S/c1-2-11-22(19,20)12-8-18-16(6-9-21-10-7-16)14-4-3-5-15(17)13-14/h3-5,13,18H,2,6-12H2,1H3 |
| InChIKey | MMXIKXFUWQZNOK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |