C20H28N2O3S — CID 122102453
1-[[3-(cyclopentylsulfanylmethyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid (PubChem CID 122102453) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is 1-[[3-(cyclopentylsulfanylmethyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-[[3-(cyclopentylsulfanylmethyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122102453 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | 1-[[3-(cyclopentylsulfanylmethyl)phenyl]carbamoyl]-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)Nc2cccc(CSC3CCCC3)c2)C1 |
| InChI | InChI=1S/C20H28N2O3S/c1-14-9-16(19(23)24)12-22(11-14)20(25)21-17-6-4-5-15(10-17)13-26-18-7-2-3-8-18/h4-6,10,14,16,18H,2-3,7-9,11-13H2,1H3,(H,21,25)(H,23,24) |
| InChIKey | HGXDWHQJNJHXBU-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |