C18H26N2O3S — CID 122084918
3-[[3-(cyclohexylsulfanylmethyl)phenyl]carbamoyl-methylamino]propanoic acid (PubChem CID 122084918) has the molecular formula C18H26N2O3S and a molecular weight of 350.48 g/mol. Its IUPAC name is 3-[[3-(cyclohexylsulfanylmethyl)phenyl]carbamoyl-methylamino]propanoic acid.
| Compound Name | 3-[[3-(cyclohexylsulfanylmethyl)phenyl]carbamoyl-methylamino]propanoic acid |
|---|---|
| PubChem CID | 122084918 |
| Molecular Formula | C18H26N2O3S |
| Molecular Weight | 350.48 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3-[[3-(cyclohexylsulfanylmethyl)phenyl]carbamoyl-methylamino]propanoic acid |
| SMILES | CN(CCC(=O)O)C(=O)Nc1cccc(CSC2CCCCC2)c1 |
| InChI | InChI=1S/C18H26N2O3S/c1-20(11-10-17(21)22)18(23)19-15-7-5-6-14(12-15)13-24-16-8-3-2-4-9-16/h5-7,12,16H,2-4,8-11,13H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | UGKTYTMJVYOVER-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |