C14H18O2S — CID 28914135
3-(cyclohexylsulfanylmethyl)benzoic acid (PubChem CID 28914135) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 3-(cyclohexylsulfanylmethyl)benzoic acid.
| Compound Name | 3-(cyclohexylsulfanylmethyl)benzoic acid |
|---|---|
| PubChem CID | 28914135 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 3-(cyclohexylsulfanylmethyl)benzoic acid |
| SMILES | O=C(O)c1cccc(CSC2CCCCC2)c1 |
| InChI | InChI=1S/C14H18O2S/c15-14(16)12-6-4-5-11(9-12)10-17-13-7-2-1-3-8-13/h4-6,9,13H,1-3,7-8,10H2,(H,15,16) |
| InChIKey | IBJAGEZUEWJHDZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |