3-(3-cyclopentylsulfanylpropoxy)benzoic acid

C15H20O3S — CID 63115754

IUPAC3-(3-cyclopentylsulfanylpropoxy)benzoic acid
SMILESO=C(O)c1cccc(OCCCSC2CCCC2)c1
InChIInChI=1S/C15H20O3S/c16-15(17)12-5-3-6-13(11-12)18-9-4-10-19-14-7-1-2-8-14/h3,5-6,11,14H,1-2,4,7-10H2,(H,16,17)
InChIKeyVBISCQUSEOSSEZ-UHFFFAOYSA-N
MW280.39 g/mol
LogP3.83
Rot. Bonds7

About 3-(3-cyclopentylsulfanylpropoxy)benzoic acid

3-(3-cyclopentylsulfanylpropoxy)benzoic acid (PubChem CID 63115754) has the molecular formula C15H20O3S and a molecular weight of 280.39 g/mol. Its IUPAC name is 3-(3-cyclopentylsulfanylpropoxy)benzoic acid.

Molecular Properties

Compound Name3-(3-cyclopentylsulfanylpropoxy)benzoic acid
PubChem CID63115754
Molecular FormulaC15H20O3S
Molecular Weight280.39 g/mol
Exact Mass280.11
IUPAC Name3-(3-cyclopentylsulfanylpropoxy)benzoic acid
SMILESO=C(O)c1cccc(OCCCSC2CCCC2)c1
InChIInChI=1S/C15H20O3S/c16-15(17)12-5-3-6-13(11-12)18-9-4-10-19-14-7-1-2-8-14/h3,5-6,11,14H,1-2,4,7-10H2,(H,16,17)
InChIKeyVBISCQUSEOSSEZ-UHFFFAOYSA-N
XLogP3.83
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500280.39
LogP ≤ 53.83
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 3-(3-cyclopentylsulfanylpropoxy)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

3-(3-cyclohexylsulfanylpropoxy)benzoic acid
CID 63529816
3-(2-cyclohexylsulfanylethoxy)benzoic acid
CID 60874387
4-(3-cyclopentylsulfanylpropoxy)benzoic acid
CID 63115753
3-[3-(3-hydroxypropylsulfanyl)propoxy]benzoic acid
CID 66127273
3-[3-(3-methoxypropylsulfanyl)propoxy]benzoic acid
CID 63857268
3-[3-(cyclopropylmethoxy)propoxy]benzoic acid
CID 55180706
3-(cyclooctylmethoxy)benzoic acid
CID 58347494
3-[2-[cyclohexyl(methyl)amino]ethoxy]benzoic acid
CID 22680674
3-[3-[cyclopentyl(ethyl)amino]propoxy]benzoic acid
CID 63066891
3-[2-[(2-hydroxycyclohexyl)amino]ethoxy]benzoic acid
CID 103249841
3-[3-(2-cyclohexylsulfanylethoxy)phenyl]prop-2-enoic acid
CID 76908963
3-[2-(cyclopropylmethoxy)ethoxy]benzoic acid
CID 43532308

Frequently Asked Questions

What is the IUPAC name of 3-(3-cyclopentylsulfanylpropoxy)benzoic acid?
The IUPAC name of 3-(3-cyclopentylsulfanylpropoxy)benzoic acid (CID 63115754) is 3-(3-cyclopentylsulfanylpropoxy)benzoic acid.
What is the SMILES notation for 3-(3-cyclopentylsulfanylpropoxy)benzoic acid?
The canonical SMILES for 3-(3-cyclopentylsulfanylpropoxy)benzoic acid is O=C(O)c1cccc(OCCCSC2CCCC2)c1.
What is the InChIKey of 3-(3-cyclopentylsulfanylpropoxy)benzoic acid?
The InChIKey is VBISCQUSEOSSEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3S/c16-15(17)12-5-3-6-13(11-12)18-9-4-10-19-14-7-1-2-8-14/h3,5-6,11,14H,1-2,4,7-10H2,(H,16,17).
What are the key properties of 3-(3-cyclopentylsulfanylpropoxy)benzoic acid?
3-(3-cyclopentylsulfanylpropoxy)benzoic acid has a molecular weight of 280.39 g/mol, XLogP of 3.83, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-cyclopentylsulfanylpropoxy)benzoic acid is sourced from PubChem (CID 63115754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).