C17H22O3S — CID 76908963
3-[3-(2-cyclohexylsulfanylethoxy)phenyl]prop-2-enoic acid (PubChem CID 76908963) has the molecular formula C17H22O3S and a molecular weight of 306.43 g/mol. Its IUPAC name is 3-[3-(2-cyclohexylsulfanylethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[3-(2-cyclohexylsulfanylethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76908963 |
| Molecular Formula | C17H22O3S |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | 3-[3-(2-cyclohexylsulfanylethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1cccc(OCCSC2CCCCC2)c1 |
| InChI | InChI=1S/C17H22O3S/c18-17(19)10-9-14-5-4-6-15(13-14)20-11-12-21-16-7-2-1-3-8-16/h4-6,9-10,13,16H,1-3,7-8,11-12H2,(H,18,19) |
| InChIKey | WZYPNQDIPGCVEA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|