C11H21NO5S — CID 122103589
1-(2-methoxybutylsulfonyl)-3-methylpyrrolidine-3-carboxylic acid (PubChem CID 122103589) has the molecular formula C11H21NO5S and a molecular weight of 279.36 g/mol. Its IUPAC name is 1-(2-methoxybutylsulfonyl)-3-methylpyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-methoxybutylsulfonyl)-3-methylpyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122103589 |
| Molecular Formula | C11H21NO5S |
| Molecular Weight | 279.36 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-(2-methoxybutylsulfonyl)-3-methylpyrrolidine-3-carboxylic acid |
| SMILES | CCC(CS(=O)(=O)N1CCC(C)(C(=O)O)C1)OC |
| InChI | InChI=1S/C11H21NO5S/c1-4-9(17-3)7-18(15,16)12-6-5-11(2,8-12)10(13)14/h9H,4-8H2,1-3H3,(H,13,14) |
| InChIKey | HYVOPCITFFAUBZ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.36 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |