C15H20N2O6S — CID 122104308
1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid (PubChem CID 122104308) has the molecular formula C15H20N2O6S and a molecular weight of 356.40 g/mol. Its IUPAC name is 1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122104308 |
| Molecular Formula | C15H20N2O6S |
| Molecular Weight | 356.40 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | 1-(2,6-dimethyl-4-nitrophenyl)sulfonyl-6-methylpiperidine-3-carboxylic acid |
| SMILES | Cc1cc([N+](=O)[O-])cc(C)c1S(=O)(=O)N1CC(C(=O)O)CCC1C |
| InChI | InChI=1S/C15H20N2O6S/c1-9-6-13(17(20)21)7-10(2)14(9)24(22,23)16-8-12(15(18)19)5-4-11(16)3/h6-7,11-12H,4-5,8H2,1-3H3,(H,18,19) |
| InChIKey | OWAQREWLWVDNOB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 117.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|