C21H23N3O4 — CID 122108251
2-[(2-methoxyphenyl)methyl]-3-[[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid (PubChem CID 122108251) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-3-[[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-3-[[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122108251 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-3-[[2-(1-methylindazol-3-yl)acetyl]amino]propanoic acid |
| SMILES | COc1ccccc1CC(CNC(=O)Cc1nn(C)c2ccccc12)C(=O)O |
| InChI | InChI=1S/C21H23N3O4/c1-24-18-9-5-4-8-16(18)17(23-24)12-20(25)22-13-15(21(26)27)11-14-7-3-6-10-19(14)28-2/h3-10,15H,11-13H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | GTKAZGIISNIFDP-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |