C17H21NO4 — CID 122108247
2-[(2-methoxyphenyl)methyl]-3-(spiro[2.2]pentane-2-carbonylamino)propanoic acid (PubChem CID 122108247) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-[(2-methoxyphenyl)methyl]-3-(spiro[2.2]pentane-2-carbonylamino)propanoic acid.
| Compound Name | 2-[(2-methoxyphenyl)methyl]-3-(spiro[2.2]pentane-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 122108247 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-[(2-methoxyphenyl)methyl]-3-(spiro[2.2]pentane-2-carbonylamino)propanoic acid |
| SMILES | COc1ccccc1CC(CNC(=O)C1CC12CC2)C(=O)O |
| InChI | InChI=1S/C17H21NO4/c1-22-14-5-3-2-4-11(14)8-12(16(20)21)10-18-15(19)13-9-17(13)6-7-17/h2-5,12-13H,6-10H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | OKJKAJRSRCGPFU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |