C18H23NO4 — CID 124686598
(2S)-2-[[[(1R)-cyclohex-3-ene-1-carbonyl]amino]methyl]-3-(2-methoxyphenyl)propanoic acid (PubChem CID 124686598) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (2S)-2-[[[(1R)-cyclohex-3-ene-1-carbonyl]amino]methyl]-3-(2-methoxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[[(1R)-cyclohex-3-ene-1-carbonyl]amino]methyl]-3-(2-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 124686598 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (2S)-2-[[[(1R)-cyclohex-3-ene-1-carbonyl]amino]methyl]-3-(2-methoxyphenyl)propanoic acid |
| SMILES | COc1ccccc1C[C@@H](CNC(=O)[C@H]1CC=CCC1)C(=O)O |
| InChI | InChI=1S/C18H23NO4/c1-23-16-10-6-5-9-14(16)11-15(18(21)22)12-19-17(20)13-7-3-2-4-8-13/h2-3,5-6,9-10,13,15H,4,7-8,11-12H2,1H3,(H,19,20)(H,21,22)/t13-,15-/m0/s1 |
| InChIKey | YMYXSRTWQPLJMJ-ZFWWWQNUSA-N |
| XLogP | 2.41 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|