C13H16N2O6 — CID 122108829
3-[(2,4-dimethyl-5-nitrobenzoyl)amino]-2-methoxypropanoic acid (PubChem CID 122108829) has the molecular formula C13H16N2O6 and a molecular weight of 296.28 g/mol. Its IUPAC name is 3-[(2,4-dimethyl-5-nitrobenzoyl)amino]-2-methoxypropanoic acid.
| Compound Name | 3-[(2,4-dimethyl-5-nitrobenzoyl)amino]-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 122108829 |
| Molecular Formula | C13H16N2O6 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | 3-[(2,4-dimethyl-5-nitrobenzoyl)amino]-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)c1cc([N+](=O)[O-])c(C)cc1C)C(=O)O |
| InChI | InChI=1S/C13H16N2O6/c1-7-4-8(2)10(15(19)20)5-9(7)12(16)14-6-11(21-3)13(17)18/h4-5,11H,6H2,1-3H3,(H,14,16)(H,17,18) |
| InChIKey | XOLIPHXFPOFMAI-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 118.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|