C14H18N2O5 — CID 122111192
(2S)-2-[(2,4-dimethyl-5-nitrobenzoyl)amino]-3-methylbutanoic acid (PubChem CID 122111192) has the molecular formula C14H18N2O5 and a molecular weight of 294.31 g/mol. Its IUPAC name is (2S)-2-[(2,4-dimethyl-5-nitrobenzoyl)amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[(2,4-dimethyl-5-nitrobenzoyl)amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 122111192 |
| Molecular Formula | C14H18N2O5 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.12 |
| IUPAC Name | (2S)-2-[(2,4-dimethyl-5-nitrobenzoyl)amino]-3-methylbutanoic acid |
| SMILES | Cc1cc(C)c([N+](=O)[O-])cc1C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C14H18N2O5/c1-7(2)12(14(18)19)15-13(17)10-6-11(16(20)21)9(4)5-8(10)3/h5-7,12H,1-4H3,(H,15,17)(H,18,19)/t12-/m0/s1 |
| InChIKey | YGOZWRMXJRVKAC-LBPRGKRZSA-N |
| XLogP | 2.05 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|