C19H19F2NO3 — CID 122109856
2-[2-fluoro-4-[[4-(2-fluorophenyl)-2-methylbutanoyl]amino]phenyl]acetic acid (PubChem CID 122109856) has the molecular formula C19H19F2NO3 and a molecular weight of 347.36 g/mol. Its IUPAC name is 2-[2-fluoro-4-[[4-(2-fluorophenyl)-2-methylbutanoyl]amino]phenyl]acetic acid.
| Compound Name | 2-[2-fluoro-4-[[4-(2-fluorophenyl)-2-methylbutanoyl]amino]phenyl]acetic acid |
|---|---|
| PubChem CID | 122109856 |
| Molecular Formula | C19H19F2NO3 |
| Molecular Weight | 347.36 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 2-[2-fluoro-4-[[4-(2-fluorophenyl)-2-methylbutanoyl]amino]phenyl]acetic acid |
| SMILES | CC(CCc1ccccc1F)C(=O)Nc1ccc(CC(=O)O)c(F)c1 |
| InChI | InChI=1S/C19H19F2NO3/c1-12(6-7-13-4-2-3-5-16(13)20)19(25)22-15-9-8-14(10-18(23)24)17(21)11-15/h2-5,8-9,11-12H,6-7,10H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | JRRRWJQKVPZZJF-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |